FE5
5-(4-azanyl-1-propan-2-yl-pyrazolo[3,4-d]pyrimidin-3-yl)-1,3-benzoxazol-2-amine
Find entries where: FE5
is present as a standalone ligand in 1 entries
Chemical Component Summary | |
|---|---|
| Name | 5-(4-azanyl-1-propan-2-yl-pyrazolo[3,4-d]pyrimidin-3-yl)-1,3-benzoxazol-2-amine |
| Identifiers | 5-(4-azanyl-1-propan-2-yl-pyrazolo[3,4-d]pyrimidin-3-yl)-1,3-benzoxazol-2-amine |
| Formula | C15 H15 N7 O |
| Molecular Weight | 309.326 |
| Type | NON-POLYMER |
| Isomeric SMILES | CC(C)n1c2c(c(n1)c3ccc4c(c3)nc(o4)N)c(ncn2)N |
| InChI | InChI=1S/C15H15N7O/c1-7(2)22-14-11(13(16)18-6-19-14)12(21-22)8-3-4-10-9(5-8)20-15(17)23-10/h3-7H,1-2H3,(H2,17,20)(H2,16,18,19) |
| InChIKey | GYLDXIAOMVERTK-UHFFFAOYSA-N |
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 38 |
| Chiral Atom Count | 0 |
| Bond Count | 41 |
| Aromatic Bond Count | 20 |
Drug Info: DrugBank
| DrugBank ID | DB11836 |
|---|---|
| Name | Sapanisertib |
| Groups | investigational |
| Description | Sapanisertib has been used in trials studying the treatment of HCC, Solid Tumor, Gliosarcoma, Liver Cancer, and Glioblastoma, among others. |
| Synonyms |
|
| Categories |
|
| CAS number | 1224844-38-5 |
Related Resource References
| Resource Name | Reference |
|---|---|
| Pharos | CHEMBL3545097 |
| PubChem | 45375953 |
| ChEMBL | CHEMBL3545097 |
| ChEBI | CHEBI:91450 |
